CAS No: 196597-77-0, Chemical Name: 4,5-Dibromo-1,2,6,7-tertahydro-8H-indeno[5,4-b]furan-8-one
the physical and chemical property of 196597-77-0, 4,5-Dibromo-1,2,6,7-tertahydro-8H-indeno[5,4-b]furan-8-one is provided by ChemNet.com
ChemNet > CAS > 196597-77-0 4,5-Dibromo-1,2,6,7-tertahydro-8H-indeno[5,4-b]furan-8-one
196597-77-0 4,5-Dibromo-1,2,6,7-tertahydro-8H-indeno[5,4-b]furan-8-one
| Naam product |
4,5-Dibromo-1,2,6,7-tertahydro-8H-indeno[5,4-b]furan-8-one |
| Synoniemen |
4,5-Dibromo-1,2,6,7-tertahydro-8H-indeno[5,4-β]furan-8-one; 4,5-dibromo-1,2,6,7-tetrahydro-8H-indeno[5,4-b]furan-8-one |
| MF |
C11H8Br2O2 |
| Molecuulgewicht |
331.988 |
| InChI |
InChI=1/C11H8Br2O2/c12-9-5-1-2-7(14)8(5)6-3-4-15-11(6)10(9)13/h1-4H2 |
| CAS-nummer |
196597-77-0 |
| Moleculaire Structuur |
![196597-77-0 4,5-Dibromo-1,2,6,7-tertahydro-8H-indeno[5,4-b]furan-8-one](https://images-a.chemnet.com/suppliers/chembase/cas132/196597-77-0.png)
|
| Dichtheid |
1.982g/cm3 |
| Smeltpunt |
224-2260C |
| Kookpunt |
448.593°C at 760 mmHg |
| Brekingsindex |
1.677 |
| Vlampunt |
225.101°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
|
|
